Difference between revisions of "Pyruvate-Dehydrogenase-Phosphoserine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-vfuothlcsa-n * mol...") |
(Created page with "Category:metabolite == Metabolite Protein-N-acetyl-D-glucosamine-L-thr == * common-name: ** an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein] == Reaction(s) kno...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-N-acetyl-D-glucosamine-L-thr == |
* common-name: | * common-name: | ||
| − | ** β-d- | + | ** an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11890]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11890]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=β-d- | + | {{#set: common-name=an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein]}} |
| − | |||
| − | |||
Revision as of 11:19, 15 January 2021
Contents
Metabolite Protein-N-acetyl-D-glucosamine-L-thr
- common-name:
- an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
