Difference between revisions of "HEXANOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SUPER-OXIDE == * common-name: ** superoxide * smiles: ** [o-]o * inchi-key: ** ouuqczgpvncoij-uhfffaoysa-m * molecular-weight: ** 31.999...") |
(Created page with "Category:metabolite == Metabolite CPD0-1812 == * common-name: ** 2-oleoylglycerol * smiles: ** ccccccccc=ccccccccc(=o)oc(co)co * inchi-key: ** upwgqkdvauruge-ktkrtigzsa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-1812 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-oleoylglycerol |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccccccc(=o)oc(co)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** upwgqkdvauruge-ktkrtigzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 356.545 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15088]] |
| + | * [[RXN-15090]] | ||
| + | * [[RXN-15091]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-oleoylglycerol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=upwgqkdvauruge-ktkrtigzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=356.545}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD0-1812
- common-name:
- 2-oleoylglycerol
- smiles:
- ccccccccc=ccccccccc(=o)oc(co)co
- inchi-key:
- upwgqkdvauruge-ktkrtigzsa-n
- molecular-weight:
- 356.545
