Difference between revisions of "16-HYDROXYPALMITATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15279 == * common-name: ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide * smiles: ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o...")
(Created page with "Category:metabolite == Metabolite CPD0-2184 == * common-name: ** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate * smiles: ** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15279 ==
+
== Metabolite CPD0-2184 ==
 
* common-name:
 
* common-name:
** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
+
** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
 
* smiles:
 
* smiles:
** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
+
** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** sjhlsluuwibqns-tylceogasa-m
+
** wcjyzufkktynlb-aritwgjrsa-l
 
* molecular-weight:
 
* molecular-weight:
** 460.481
+
** 210.143
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12070]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14430]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide}}
+
{{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}}
{{#set: inchi-key=inchikey=sjhlsluuwibqns-tylceogasa-m}}
+
{{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}}
{{#set: molecular-weight=460.481}}
+
{{#set: molecular-weight=210.143}}

Revision as of 11:19, 15 January 2021

Metabolite CPD0-2184

  • common-name:
    • (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
  • smiles:
    • c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
  • inchi-key:
    • wcjyzufkktynlb-aritwgjrsa-l
  • molecular-weight:
    • 210.143

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality