Difference between revisions of "CPD-8609"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16825 == * common-name: ** (s)-equol 4'-sulfate * smiles: ** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite S-24-DINITROPHENYLGLUTATHIONE == * common-name: ** 2,4-dinitrophenyl-s-glutathione * smiles: ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-24-DINITROPHENYLGLUTATHIONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2,4-dinitrophenyl-s-glutathione |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fxeukvkgtkddiq-uwvggrqhsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 472.406 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[GST-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[GST-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2,4-dinitrophenyl-s-glutathione}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=472.406}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite S-24-DINITROPHENYLGLUTATHIONE
- common-name:
- 2,4-dinitrophenyl-s-glutathione
- smiles:
- c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
- inchi-key:
- fxeukvkgtkddiq-uwvggrqhsa-m
- molecular-weight:
- 472.406
