Difference between revisions of "PHYTYL-PYROPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytidine4-tRNAGly-GCC == * common-name: ** a cytidine4 in trnagly == Reaction(s) known to consume the compound == * RXN-12478 == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-17312 == * common-name: ** docosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-17312 == |
* common-name: | * common-name: | ||
− | ** | + | ** docosahexaenoyl-coa |
+ | * smiles: | ||
+ | ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** menfzxmqsyyvrk-crcgjgbysa-j | ||
+ | * molecular-weight: | ||
+ | ** 1073.981 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-16063]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-16063]] | ||
+ | * [[RXN-16137]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=docosahexaenoyl-coa}} |
+ | {{#set: inchi-key=inchikey=menfzxmqsyyvrk-crcgjgbysa-j}} | ||
+ | {{#set: molecular-weight=1073.981}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-17312
- common-name:
- docosahexaenoyl-coa
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- menfzxmqsyyvrk-crcgjgbysa-j
- molecular-weight:
- 1073.981