Difference between revisions of "CPD-2189"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DOPAQUINONE == * common-name: ** dopaquinone * smiles: ** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1) * inchi-key: ** ahmiduvksgchau-lurjtmie...")
(Created page with "Category:metabolite == Metabolite XYLULOSE-5-PHOSPHATE == * common-name: ** d-xylulose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)c(o)c(=o)co * inchi-key: ** fnzlkvnu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DOPAQUINONE ==
+
== Metabolite XYLULOSE-5-PHOSPHATE ==
 
* common-name:
 
* common-name:
** dopaquinone
+
** d-xylulose 5-phosphate
 
* smiles:
 
* smiles:
** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1)
+
** c(op([o-])(=o)[o-])c(o)c(o)c(=o)co
 
* inchi-key:
 
* inchi-key:
** ahmiduvksgchau-lurjtmiesa-n
+
** fnzlkvnuwiipsj-rfzpgflssa-l
 
* molecular-weight:
 
* molecular-weight:
** 195.174
+
** 228.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1TRANSKETO-RXN]]
 +
* [[2TRANSKETO-RXN]]
 +
* [[RIBULP3EPIM-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
+
* [[1TRANSKETO-RXN]]
* [[RXN-13061]]
+
* [[2TRANSKETO-RXN]]
 +
* [[RIBULP3EPIM-RXN]]
 +
* [[XYLULOKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dopaquinone}}
+
{{#set: common-name=d-xylulose 5-phosphate}}
{{#set: inchi-key=inchikey=ahmiduvksgchau-lurjtmiesa-n}}
+
{{#set: inchi-key=inchikey=fnzlkvnuwiipsj-rfzpgflssa-l}}
{{#set: molecular-weight=195.174}}
+
{{#set: molecular-weight=228.095}}

Revision as of 11:19, 15 January 2021

Metabolite XYLULOSE-5-PHOSPHATE

  • common-name:
    • d-xylulose 5-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c(o)c(o)c(=o)co
  • inchi-key:
    • fnzlkvnuwiipsj-rfzpgflssa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality