Difference between revisions of "2-O-Methylcytidine-34-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9924 == * common-name: ** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate * smiles: ** c=c(c(=o)[o-])oc1(cc=c(c(=o)cc...")
(Created page with "Category:metabolite == Metabolite DIHYDROLIPOAMIDE == * common-name: ** dihydrolipoamide * smiles: ** c(ccc(n)=o)cc(s)ccs * inchi-key: ** vlyugyakyzetrf-ssdottswsa-n * mol...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9924 ==
+
== Metabolite DIHYDROLIPOAMIDE ==
 
* common-name:
 
* common-name:
** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate
+
** dihydrolipoamide
 
* smiles:
 
* smiles:
** c=c(c(=o)[o-])oc1(cc=c(c(=o)ccc(=o)[o-])c(c(o)1)c(=o)[o-])
+
** c(ccc(n)=o)cc(s)ccs
 
* inchi-key:
 
* inchi-key:
** jkjglrglomrxfn-mvwjerbfsa-k
+
** vlyugyakyzetrf-ssdottswsa-n
 
* molecular-weight:
 
* molecular-weight:
** 325.251
+
** 207.348
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AKGDHe2r]]
 +
* [[DIHYDLIPACETRANS-RXN]]
 +
* [[PDHe3mr]]
 +
* [[RXN-18331]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.64-RXN]]
+
* [[AKGDHe2r]]
 +
* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
 +
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
 +
* [[PDHe3mr]]
 +
* [[RXN-18331]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate}}
+
{{#set: common-name=dihydrolipoamide}}
{{#set: inchi-key=inchikey=jkjglrglomrxfn-mvwjerbfsa-k}}
+
{{#set: inchi-key=inchikey=vlyugyakyzetrf-ssdottswsa-n}}
{{#set: molecular-weight=325.251}}
+
{{#set: molecular-weight=207.348}}

Revision as of 11:19, 15 January 2021

Metabolite DIHYDROLIPOAMIDE

  • common-name:
    • dihydrolipoamide
  • smiles:
    • c(ccc(n)=o)cc(s)ccs
  • inchi-key:
    • vlyugyakyzetrf-ssdottswsa-n
  • molecular-weight:
    • 207.348

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality