Difference between revisions of "CPD-17640"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-342 == * common-name: ** 5α-androstane-3,17-dione * smiles: ** cc12(ccc(c[ch]1cc[ch]4([ch]2ccc3([ch](ccc(=o)3)4)c))=o) * inchi-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-342 == |
* common-name: | * common-name: | ||
− | ** & | + | ** 5α-androstane-3,17-dione |
* smiles: | * smiles: | ||
− | ** | + | ** cc12(ccc(c[ch]1cc[ch]4([ch]2ccc3([ch](ccc(=o)3)4)c))=o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rajwobjttgjroa-wznaksscsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 288.429 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12124]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=& | + | {{#set: common-name=5α-androstane-3,17-dione}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rajwobjttgjroa-wznaksscsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=288.429}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-342
- common-name:
- 5α-androstane-3,17-dione
- smiles:
- cc12(ccc(c[ch]1cc[ch]4([ch]2ccc3([ch](ccc(=o)3)4)c))=o)
- inchi-key:
- rajwobjttgjroa-wznaksscsa-n
- molecular-weight:
- 288.429