Difference between revisions of "Farnesylated-CAAX-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RNASE-II-DEGRADATION-SUBSTRATE-MRNA == * common-name: ** rnase ii degradation substrate mrna == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-667 == * common-name: ** o-acetyl-l-homoserine * smiles: ** cc(occc(c([o-])=o)[n+])=o * inchi-key: ** fcxzbwsiaggpcb-yfkpbyrvsa-n * m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-667 == |
* common-name: | * common-name: | ||
| − | ** | + | ** o-acetyl-l-homoserine |
| + | * smiles: | ||
| + | ** cc(occc(c([o-])=o)[n+])=o | ||
| + | * inchi-key: | ||
| + | ** fcxzbwsiaggpcb-yfkpbyrvsa-n | ||
| + | * molecular-weight: | ||
| + | ** 161.157 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ACETYLHOMOSER-CYS-RXN]] |
| + | * [[ACHMSSELCYSL]] | ||
| + | * [[ACHMSSELCYSLh]] | ||
| + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ACETYLHOMOSER-CYS-RXN]] | ||
| + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=o-acetyl-l-homoserine}} |
| + | {{#set: inchi-key=inchikey=fcxzbwsiaggpcb-yfkpbyrvsa-n}} | ||
| + | {{#set: molecular-weight=161.157}} | ||
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-667
- common-name:
- o-acetyl-l-homoserine
- smiles:
- cc(occc(c([o-])=o)[n+])=o
- inchi-key:
- fcxzbwsiaggpcb-yfkpbyrvsa-n
- molecular-weight:
- 161.157
