Difference between revisions of "Aromatic-Amino-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Pectin == * common-name: ** a pectin == Reaction(s) known to consume the compound == * 4.2.2.10-RXN * RXN-14897 == Reaction(s) kn...")
(Created page with "Category:metabolite == Metabolite MAL == * common-name: ** (s)-malate * smiles: ** c(=o)([o-])cc(o)c([o-])=o * inchi-key: ** bjepykjpyrnkow-reohclbhsa-l * molecular-weight...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Pectin ==
+
== Metabolite MAL ==
 
* common-name:
 
* common-name:
** a pectin
+
** (s)-malate
 +
* smiles:
 +
** c(=o)([o-])cc(o)c([o-])=o
 +
* inchi-key:
 +
** bjepykjpyrnkow-reohclbhsa-l
 +
* molecular-weight:
 +
** 132.073
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.2.2.10-RXN]]
+
* [[1.1.1.39-RXN]]
* [[RXN-14897]]
+
* [[FUMHYDR-RXN]]
 +
* [[MALATE-DEH-RXN]]
 +
* [[MALIC-NADP-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.2.2.10-RXN]]
+
* [[FUMHYDR-RXN]]
 +
* [[MALATE-DEH-RXN]]
 +
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[MALSYN-RXN]]
 +
* [[RXN-14937]]
 +
* [[RXN-6002]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a pectin}}
+
{{#set: common-name=(s)-malate}}
 +
{{#set: inchi-key=inchikey=bjepykjpyrnkow-reohclbhsa-l}}
 +
{{#set: molecular-weight=132.073}}

Revision as of 08:24, 15 March 2021

Metabolite MAL

  • common-name:
    • (s)-malate
  • smiles:
    • c(=o)([o-])cc(o)c([o-])=o
  • inchi-key:
    • bjepykjpyrnkow-reohclbhsa-l
  • molecular-weight:
    • 132.073

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality