Difference between revisions of "THIOMORPHOLINE-3-CARBOXYLATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1828 == * common-name: ** gdp-α-d-mannuronate * smiles: ** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)...") |
(Created page with "Category:metabolite == Metabolite CPD-10712 == * common-name: ** di-trans, poly-cis-polyprenyl diphosphate (c80) * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-10712 == |
* common-name: | * common-name: | ||
− | ** | + | ** di-trans, poly-cis-polyprenyl diphosphate (c80) |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** tunipipdjadhsr-hiqrjctmsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1264.842 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-9969]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=di-trans, poly-cis-polyprenyl diphosphate (c80)}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=tunipipdjadhsr-hiqrjctmsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1264.842}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-10712
- common-name:
- di-trans, poly-cis-polyprenyl diphosphate (c80)
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
- inchi-key:
- tunipipdjadhsr-hiqrjctmsa-k
- molecular-weight:
- 1264.842