Difference between revisions of "CPD-10712"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UTP == * common-name: ** utp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite THR-tRNAs == * common-name: ** a trnathr == Reaction(s) known to consume the compound == * THREONINE--TRNA-LIGASE-RXN == Reaction(s)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite THR-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** a trnathr |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[THREONINE--TRNA-LIGASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a trnathr}} |
− | |||
− |
Revision as of 08:24, 15 March 2021
Contents
Metabolite THR-tRNAs
- common-name:
- a trnathr