Difference between revisions of "N-formyl-L-methionyl-tRNAfmet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Gcv-H == * common-name: ** [glycine cleavage system lipoyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * ...") |
(Created page with "Category:metabolite == Metabolite 3-INDOLYLGLYCOLALDEHYDE == * common-name: ** indole-3-glycol aldehyde * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)c=o) * inchi-key: ** xkzdnwm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-INDOLYLGLYCOLALDEHYDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** indole-3-glycol aldehyde |
| + | * smiles: | ||
| + | ** c2(=c(c1(c=cc=cc=1n2))c(o)c=o) | ||
| + | * inchi-key: | ||
| + | ** xkzdnwmdlgqxml-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 175.187 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-5424]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=indole-3-glycol aldehyde}} |
| + | {{#set: inchi-key=inchikey=xkzdnwmdlgqxml-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=175.187}} | ||
Revision as of 08:24, 15 March 2021
Contents
Metabolite 3-INDOLYLGLYCOLALDEHYDE
- common-name:
- indole-3-glycol aldehyde
- smiles:
- c2(=c(c1(c=cc=cc=1n2))c(o)c=o)
- inchi-key:
- xkzdnwmdlgqxml-uhfffaoysa-n
- molecular-weight:
- 175.187
