Difference between revisions of "CPD1F-133"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Trans-D2-decenoyl-ACPs == * common-name: ** a (2e)-dec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9530 * R...")
(Created page with "Category:metabolite == Metabolite CPD-19491 == * common-name: ** 3-isopropyl-6-(methylthio)-2-oxohexanoate * smiles: ** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-] * inchi-key: ** w...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Trans-D2-decenoyl-ACPs ==
+
== Metabolite CPD-19491 ==
 
* common-name:
 
* common-name:
** a (2e)-dec-2-enoyl-[acp]
+
** 3-isopropyl-6-(methylthio)-2-oxohexanoate
 +
* smiles:
 +
** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-]
 +
* inchi-key:
 +
** wrgktdwhjsbcjr-uhfffaoysa-l
 +
* molecular-weight:
 +
** 218.224
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9530]]
+
* [[RXN-18208]]
* [[RXN-9660]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9655]]
+
* [[RXN-18208]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (2e)-dec-2-enoyl-[acp]}}
+
{{#set: common-name=3-isopropyl-6-(methylthio)-2-oxohexanoate}}
 +
{{#set: inchi-key=inchikey=wrgktdwhjsbcjr-uhfffaoysa-l}}
 +
{{#set: molecular-weight=218.224}}

Revision as of 08:24, 15 March 2021

Metabolite CPD-19491

  • common-name:
    • 3-isopropyl-6-(methylthio)-2-oxohexanoate
  • smiles:
    • c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-]
  • inchi-key:
    • wrgktdwhjsbcjr-uhfffaoysa-l
  • molecular-weight:
    • 218.224

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality