Difference between revisions of "CPD-15125"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24185 == == Reaction(s) known to consume the compound == * RXN-22198 == Reaction(s) known to produce the compound == * RXN-2220...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOVALERYL-COA == * common-name: ** 3-hydroxyisovaleryl-coa * smiles: ** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-HYDROXY-ISOVALERYL-COA == |
+ | * common-name: | ||
+ | ** 3-hydroxyisovaleryl-coa | ||
+ | * smiles: | ||
+ | ** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o | ||
+ | * inchi-key: | ||
+ | ** pevzkilcbdeobt-uhfffaoysa-j | ||
+ | * molecular-weight: | ||
+ | ** 863.619 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ECH_LPAREN_3hivcoa_RPAREN_]] |
+ | * [[RXN-14266]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ECH_LPAREN_3hivcoa_RPAREN_]] |
+ | * [[RXN-14266]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=3-hydroxyisovaleryl-coa}} | ||
+ | {{#set: inchi-key=inchikey=pevzkilcbdeobt-uhfffaoysa-j}} | ||
+ | {{#set: molecular-weight=863.619}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite 3-HYDROXY-ISOVALERYL-COA
- common-name:
- 3-hydroxyisovaleryl-coa
- smiles:
- cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
- inchi-key:
- pevzkilcbdeobt-uhfffaoysa-j
- molecular-weight:
- 863.619