Difference between revisions of "CPD-15125"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24185 == == Reaction(s) known to consume the compound == * RXN-22198 == Reaction(s) known to produce the compound == * RXN-2220...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOVALERYL-COA == * common-name: ** 3-hydroxyisovaleryl-coa * smiles: ** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-24185 ==
+
== Metabolite 3-HYDROXY-ISOVALERYL-COA ==
 +
* common-name:
 +
** 3-hydroxyisovaleryl-coa
 +
* smiles:
 +
** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
 +
* inchi-key:
 +
** pevzkilcbdeobt-uhfffaoysa-j
 +
* molecular-weight:
 +
** 863.619
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-22198]]
+
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
 +
* [[RXN-14266]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-22206]]
+
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
 +
* [[RXN-14266]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3-hydroxyisovaleryl-coa}}
 +
{{#set: inchi-key=inchikey=pevzkilcbdeobt-uhfffaoysa-j}}
 +
{{#set: molecular-weight=863.619}}

Revision as of 08:25, 15 March 2021

Metabolite 3-HYDROXY-ISOVALERYL-COA

  • common-name:
    • 3-hydroxyisovaleryl-coa
  • smiles:
    • cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
  • inchi-key:
    • pevzkilcbdeobt-uhfffaoysa-j
  • molecular-weight:
    • 863.619

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality