Difference between revisions of "Reduced-hemoproteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Octapeptides == * common-name: ** an octapeptide == Reaction(s) known to consume the compound == == Reaction(s) known to produce the comp...")
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALDEHYDE == * common-name: ** coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc=c(o)1) * inchi-key: ** dkzbbwmurdfhne-nscuhmnnsa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Octapeptides ==
+
== Metabolite CONIFERYL-ALDEHYDE ==
 
* common-name:
 
* common-name:
** an octapeptide
+
** coniferaldehyde
 +
* smiles:
 +
** coc1(=cc(c=cc=o)=cc=c(o)1)
 +
* inchi-key:
 +
** dkzbbwmurdfhne-nscuhmnnsa-n
 +
* molecular-weight:
 +
** 178.187
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.24.59-RXN]]
+
* [[RXN-1106]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an octapeptide}}
+
{{#set: common-name=coniferaldehyde}}
 +
{{#set: inchi-key=inchikey=dkzbbwmurdfhne-nscuhmnnsa-n}}
 +
{{#set: molecular-weight=178.187}}

Revision as of 08:25, 15 March 2021

Metabolite CONIFERYL-ALDEHYDE

  • common-name:
    • coniferaldehyde
  • smiles:
    • coc1(=cc(c=cc=o)=cc=c(o)1)
  • inchi-key:
    • dkzbbwmurdfhne-nscuhmnnsa-n
  • molecular-weight:
    • 178.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality