Difference between revisions of "CPD-10576"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RH-Group == * common-name: ** an organic molecule == Reaction(s) known to consume the compound == * RXN-12615 * UNSPECIFIC-MONOOXYG...")
(Created page with "Category:metabolite == Metabolite SINAPOYL-COA == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RH-Group ==
+
== Metabolite SINAPOYL-COA ==
 
* common-name:
 
* common-name:
** an organic molecule
+
** sinapoyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** rbfuwesmwrugfy-gsnioflcsa-j
 +
* molecular-weight:
 +
** 969.7
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12615]]
+
* [[RXN-1124]]
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10919]]
 +
* [[RXN-1124]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an organic molecule}}
+
{{#set: common-name=sinapoyl-coa}}
 +
{{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}}
 +
{{#set: molecular-weight=969.7}}

Revision as of 08:25, 15 March 2021

Metabolite SINAPOYL-COA

  • common-name:
    • sinapoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • rbfuwesmwrugfy-gsnioflcsa-j
  • molecular-weight:
    • 969.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality