Difference between revisions of "CPD-558"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite LANOSTEROL == * common-name: ** lanosterol * smiles: ** cc(c)=cccc([ch]1(c2(c)(c(c)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c * i...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LANOSTEROL == |
* common-name: | * common-name: | ||
− | ** | + | ** lanosterol |
* smiles: | * smiles: | ||
− | ** c(c2(c | + | ** cc(c)=cccc([ch]1(c2(c)(c(c)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cahgclmltwqznj-bqniitsrsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 426.724 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN3O-130]] |
− | + | * [[RXN66-303]] | |
− | |||
− | |||
− | |||
− | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[LANOSTEROL-SYNTHASE-RXN]] |
− | + | * [[RXN-15133]] | |
− | |||
− | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=lanosterol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cahgclmltwqznj-bqniitsrsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=426.724}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite LANOSTEROL
- common-name:
- lanosterol
- smiles:
- cc(c)=cccc([ch]1(c2(c)(c(c)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
- inchi-key:
- cahgclmltwqznj-bqniitsrsa-n
- molecular-weight:
- 426.724