Difference between revisions of "CPD1G-277"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-Stearoyl-L-Phosphatidate == * common-name: ** a 1-stearoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite DUDP == * common-name: ** dudp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** qhwztvccbmii...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DUDP == |
* common-name: | * common-name: | ||
| − | ** | + | ** dudp |
| + | * smiles: | ||
| + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) | ||
| + | * inchi-key: | ||
| + | ** qhwztvccbmiike-shyzeuofsa-k | ||
| + | * molecular-weight: | ||
| + | ** 385.14 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ATDUD]] | ||
| + | * [[ATDUDm]] | ||
| + | * [[DUDPKIN-RXN]] | ||
| + | * [[RXN-14220]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[DUDT]] |
| + | * [[DUTCP]] | ||
| + | * [[DUTUP]] | ||
| + | * [[RXN-14219]] | ||
| + | * [[RXN0-722]] | ||
| + | * [[UDPREDUCT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dudp}} |
| + | {{#set: inchi-key=inchikey=qhwztvccbmiike-shyzeuofsa-k}} | ||
| + | {{#set: molecular-weight=385.14}} | ||
Revision as of 08:26, 15 March 2021
Contents
Metabolite DUDP
- common-name:
- dudp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
- inchi-key:
- qhwztvccbmiike-shyzeuofsa-k
- molecular-weight:
- 385.14
