Difference between revisions of "1-Stearoyl-L-Phosphatidate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite mRNA-Fragments == * common-name: ** an mrna fragment == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...")
(Created page with "Category:metabolite == Metabolite CPD-505 == * common-name: ** d-myo-inositol (1,3,4,6)-tetrakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite mRNA-Fragments ==
+
== Metabolite CPD-505 ==
 
* common-name:
 
* common-name:
** an mrna fragment
+
** d-myo-inositol (1,3,4,6)-tetrakisphosphate
 +
* smiles:
 +
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 +
* inchi-key:
 +
** zawixngttztbkv-jmvowjsssa-f
 +
* molecular-weight:
 +
** 492.013
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.1.140-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.26.3-RXN]]
+
* [[2.7.1.133-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an mrna fragment}}
+
{{#set: common-name=d-myo-inositol (1,3,4,6)-tetrakisphosphate}}
 +
{{#set: inchi-key=inchikey=zawixngttztbkv-jmvowjsssa-f}}
 +
{{#set: molecular-weight=492.013}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-505

  • common-name:
    • d-myo-inositol (1,3,4,6)-tetrakisphosphate
  • smiles:
    • c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • zawixngttztbkv-jmvowjsssa-f
  • molecular-weight:
    • 492.013

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality