Difference between revisions of "CPD-10279"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11876 == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * smiles: ** coc1(=c(o)c=cc(c(o)c=o)=c1) * inchi-key: ** visajvapy...")
(Created page with "Category:metabolite == Metabolite N6-L-threonylcarbamoyladenine37-tRNAs == * common-name: ** an n6-l-threonylcarbamoyladenine37 in trna == Reaction(s) known to consume the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11876 ==
+
== Metabolite N6-L-threonylcarbamoyladenine37-tRNAs ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxyphenylglycolaldehyde
+
** an n6-l-threonylcarbamoyladenine37 in trna
* smiles:
 
** coc1(=c(o)c=cc(c(o)c=o)=c1)
 
* inchi-key:
 
** visajvapypfkcl-qmmmgpobsa-n
 
* molecular-weight:
 
** 182.176
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10915]]
 
* [[RXN-10917]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10910]]
+
* [[RXN-14570]]
* [[RXN-10913]]
 
* [[RXN-10915]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxyphenylglycolaldehyde}}
+
{{#set: common-name=an n6-l-threonylcarbamoyladenine37 in trna}}
{{#set: inchi-key=inchikey=visajvapypfkcl-qmmmgpobsa-n}}
 
{{#set: molecular-weight=182.176}}
 

Revision as of 08:26, 15 March 2021

Metabolite N6-L-threonylcarbamoyladenine37-tRNAs

  • common-name:
    • an n6-l-threonylcarbamoyladenine37 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality