Difference between revisions of "BETA-L-ARABINOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIMP == * common-name: ** dimp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** phngfppxdjjadg-rrkc...")
(Created page with "Category:metabolite == Metabolite CPD-15104 == * common-name: ** (r)-3-hydroxy-3-methyl-2-oxopentanoate * smiles: ** ccc(o)(c)c(=o)c(=o)[o-] * inchi-key: ** yjvowrawfxresp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIMP ==
+
== Metabolite CPD-15104 ==
 
* common-name:
 
* common-name:
** dimp
+
** (r)-3-hydroxy-3-methyl-2-oxopentanoate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+
** ccc(o)(c)c(=o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** phngfppxdjjadg-rrkcrqdmsa-l
+
** yjvowrawfxresp-zcfiwibfsa-m
 
* molecular-weight:
 
* molecular-weight:
** 330.193
+
** 145.135
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[KARI_LPAREN_23dhmp_RPAREN_]]
 +
* [[RXN-14106]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-1602]]
+
* [[RXN-14106]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dimp}}
+
{{#set: common-name=(r)-3-hydroxy-3-methyl-2-oxopentanoate}}
{{#set: inchi-key=inchikey=phngfppxdjjadg-rrkcrqdmsa-l}}
+
{{#set: inchi-key=inchikey=yjvowrawfxresp-zcfiwibfsa-m}}
{{#set: molecular-weight=330.193}}
+
{{#set: molecular-weight=145.135}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-15104

  • common-name:
    • (r)-3-hydroxy-3-methyl-2-oxopentanoate
  • smiles:
    • ccc(o)(c)c(=o)c(=o)[o-]
  • inchi-key:
    • yjvowrawfxresp-zcfiwibfsa-m
  • molecular-weight:
    • 145.135

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality