Difference between revisions of "CPD-665"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12565 == * common-name: ** n-acetyl-d-galactosamine 6-o-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-239 == * common-name: ** cysteamine * smiles: ** c(cs)[n+] * inchi-key: ** ufulayfcsouiov-uhfffaoysa-o * molecular-weight: ** 78.152...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-239 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cysteamine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(cs)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufulayfcsouiov-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 78.152 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[CYSTEAMINE-DIOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cysteamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufulayfcsouiov-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=78.152}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite CPD-239
- common-name:
- cysteamine
- smiles:
- c(cs)[n+]
- inchi-key:
- ufulayfcsouiov-uhfffaoysa-o
- molecular-weight:
- 78.152
