Difference between revisions of "Myo-inositol-polyphosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...")
(Created page with "Category:metabolite == Metabolite CPD-15654 == * common-name: ** 2-trans, 4-cis-undecadienoyl-coa * smiles: ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CANAVANINOSUCCINATE ==
+
== Metabolite CPD-15654 ==
 
* common-name:
 
* common-name:
** canavaninosuccinate
+
** 2-trans, 4-cis-undecadienoyl-coa
 
* smiles:
 
* smiles:
** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
+
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** sgymgugigtwwlu-rolxfiacsa-m
+
** szkpluulggerfd-nfpsboapsa-j
 
* molecular-weight:
 
* molecular-weight:
** 291.24
+
** 927.749
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-22]]
+
* [[RXN-14776]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10]]
+
* [[RXN-14775]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=canavaninosuccinate}}
+
{{#set: common-name=2-trans, 4-cis-undecadienoyl-coa}}
{{#set: inchi-key=inchikey=sgymgugigtwwlu-rolxfiacsa-m}}
+
{{#set: inchi-key=inchikey=szkpluulggerfd-nfpsboapsa-j}}
{{#set: molecular-weight=291.24}}
+
{{#set: molecular-weight=927.749}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-15654

  • common-name:
    • 2-trans, 4-cis-undecadienoyl-coa
  • smiles:
    • ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • szkpluulggerfd-nfpsboapsa-j
  • molecular-weight:
    • 927.749

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality