Difference between revisions of "3-Hydroxy-Terminated-DNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17385 == * common-name: ** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=...")
(Created page with "Category:metabolite == Metabolite tRNA-with-7-aminomethyl-7-deazaguanine == * common-name: ** a 7-aminomethyl-7-deazaguanosine34 in trna == Reaction(s) known to consume th...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17385 ==
+
== Metabolite tRNA-with-7-aminomethyl-7-deazaguanine ==
 
* common-name:
 
* common-name:
−
** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** a 7-aminomethyl-7-deazaguanosine34 in trna
−
* smiles:
 
−
** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
−
* inchi-key:
 
−
** krifzirxaaithr-kwfbmmabsa-j
 
−
* molecular-weight:
 
−
** 1102.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16134]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16132]]
+
* [[RXN0-1321]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=a 7-aminomethyl-7-deazaguanosine34 in trna}}
−
{{#set: inchi-key=inchikey=krifzirxaaithr-kwfbmmabsa-j}}
 
−
{{#set: molecular-weight=1102.034}}
 

Revision as of 08:27, 15 March 2021

Metabolite tRNA-with-7-aminomethyl-7-deazaguanine

  • common-name:
    • a 7-aminomethyl-7-deazaguanosine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-Hydroxy-Terminated-DNAs&oldid=125042"