Difference between revisions of "S-1-PHENYLETHANOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite QUINATE == * common-name: ** l-quinate * smiles: ** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1) * inchi-key: ** aawzdtnxlsgcek-wywmibkrsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite Glutamine-synthetase-Tyr == * common-name: ** a [glutamine-synthetase]-l-tyrosine == Reaction(s) known to consume the compound == * GSA...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Glutamine-synthetase-Tyr == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [glutamine-synthetase]-l-tyrosine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[GSADENYLATION-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [glutamine-synthetase]-l-tyrosine}} |
| − | |||
| − | |||
Revision as of 08:27, 15 March 2021
Contents
Metabolite Glutamine-synthetase-Tyr
- common-name:
- a [glutamine-synthetase]-l-tyrosine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glutamine-synthetase]-l-tyrosine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
