Difference between revisions of "UDP-D-GALACTURONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-313 == * common-name: ** propane-1,3-diamine * smiles: ** c(cc[n+])[n+] * inchi-key: ** xfnjvjplkcpibv-uhfffaoysa-p * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite CPD-12016 == * common-name: ** n-acetyl-serotonin glucuronide * smiles: ** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12016 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-serotonin glucuronide |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** drkqfnyksnwotc-rngzqalnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 393.372 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11060]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-serotonin glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=393.372}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite CPD-12016
- common-name:
- n-acetyl-serotonin glucuronide
- smiles:
- cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
- inchi-key:
- drkqfnyksnwotc-rngzqalnsa-m
- molecular-weight:
- 393.372
