Difference between revisions of "5-METHYLTHIOADENOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-Alkenylglycerophosphoethanolamines == * common-name: ** a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine == Reaction(s) known to con...")
(Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * smiles: ** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-Alkenylglycerophosphoethanolamines ==
+
== Metabolite CROTONYL-COA ==
 
* common-name:
 
* common-name:
** a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine
+
** crotonyl-coa
 +
* smiles:
 +
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
 +
* inchi-key:
 +
** kfwwcmjsysspsk-bogfjhsmsa-j
 +
* molecular-weight:
 +
** 831.577
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACOAD1f]]
 +
* [[ACOAR1h]]
 +
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 +
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[HBCHL]]
 +
* [[HBCHLm]]
 +
* [[RXN-11667]]
 +
* [[RXN-12558]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17735]]
+
* [[ACOA40OR]]
 +
* [[ACOAD1f]]
 +
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[HBCHL]]
 +
* [[HBCHLm]]
 +
* [[RXN-11667]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine}}
+
{{#set: common-name=crotonyl-coa}}
 +
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
 +
{{#set: molecular-weight=831.577}}

Revision as of 08:27, 15 March 2021

Metabolite CROTONYL-COA

  • common-name:
    • crotonyl-coa
  • smiles:
    • cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
  • inchi-key:
    • kfwwcmjsysspsk-bogfjhsmsa-j
  • molecular-weight:
    • 831.577

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality