Difference between revisions of "Release-factor-N5-Methyl-L-glutamine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * smiles: ** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2)) * inchi-key: ** meymblgokydglz-uh...")
(Created page with "Category:metabolite == Metabolite CPD-4125 == * common-name: ** avenasterol * smiles: ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE ==
+
== Metabolite CPD-4125 ==
 
* common-name:
 
* common-name:
** preq1
+
** avenasterol
 
* smiles:
 
* smiles:
** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2))
+
** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** meymblgokydglz-uhfffaoysa-o
+
** mcwvpsbqqxuctb-oqtioydcsa-n
 
* molecular-weight:
 
* molecular-weight:
** 180.189
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-1321]]
+
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 +
* [[RXN-4209]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=preq1}}
+
{{#set: common-name=avenasterol}}
{{#set: inchi-key=inchikey=meymblgokydglz-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=mcwvpsbqqxuctb-oqtioydcsa-n}}
{{#set: molecular-weight=180.189}}
+
{{#set: molecular-weight=412.698}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-4125

  • common-name:
    • avenasterol
  • smiles:
    • cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • mcwvpsbqqxuctb-oqtioydcsa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality