Difference between revisions of "Release-factor-N5-Methyl-L-glutamine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * smiles: ** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2)) * inchi-key: ** meymblgokydglz-uh...") |
(Created page with "Category:metabolite == Metabolite CPD-4125 == * common-name: ** avenasterol * smiles: ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-k...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-4125 == |
* common-name: | * common-name: | ||
− | ** | + | ** avenasterol |
* smiles: | * smiles: | ||
− | ** c([ | + | ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mcwvpsbqqxuctb-oqtioydcsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 412.698 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]] |
+ | * [[RXN-4209]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=avenasterol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mcwvpsbqqxuctb-oqtioydcsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=412.698}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-4125
- common-name:
- avenasterol
- smiles:
- cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- mcwvpsbqqxuctb-oqtioydcsa-n
- molecular-weight:
- 412.698