Difference between revisions of "23S-rRNA-cytosine-1962"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Aryl-Dialkyl-Phosphate == * common-name: ** an aryl dialkyl phosphate == Reaction(s) known to consume the compound == * ARYLDIALKYLPHOS...") |
(Created page with "Category:metabolite == Metabolite UNDECAPRENYL-DIPHOSPHATE == * common-name: ** di-trans,octa-cis-undecaprenyl diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=ccc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UNDECAPRENYL-DIPHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** di-trans,octa-cis-undecaprenyl diphosphate |
+ | * smiles: | ||
+ | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c | ||
+ | * inchi-key: | ||
+ | ** ntxgvhccxvhycl-ntdveaecsa-k | ||
+ | * molecular-weight: | ||
+ | ** 924.251 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8999]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=di-trans,octa-cis-undecaprenyl diphosphate}} |
+ | {{#set: inchi-key=inchikey=ntxgvhccxvhycl-ntdveaecsa-k}} | ||
+ | {{#set: molecular-weight=924.251}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite UNDECAPRENYL-DIPHOSPHATE
- common-name:
- di-trans,octa-cis-undecaprenyl diphosphate
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c
- inchi-key:
- ntxgvhccxvhycl-ntdveaecsa-k
- molecular-weight:
- 924.251