Difference between revisions of "Proteins-with-correct-disulfides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19154 == * common-name: ** (s)-3-hydroxy-(7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
(Created page with "Category:metabolite == Metabolite Peptide-with-N-terminal-Alanine == * common-name: ** a peptide with an n-terminal l-alanine == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19154 ==
+
== Metabolite Peptide-with-N-terminal-Alanine ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(7z)-tetradecenoyl-coa
+
** a peptide with an n-terminal l-alanine
* smiles:
 
** ccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** wgcarzjtijiwsl-jcjyipitsa-j
 
* molecular-weight:
 
** 987.845
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17794]]
+
* [[3.4.11.2-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17793]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(7z)-tetradecenoyl-coa}}
+
{{#set: common-name=a peptide with an n-terminal l-alanine}}
{{#set: inchi-key=inchikey=wgcarzjtijiwsl-jcjyipitsa-j}}
 
{{#set: molecular-weight=987.845}}
 

Revision as of 08:28, 15 March 2021

Metabolite Peptide-with-N-terminal-Alanine

  • common-name:
    • a peptide with an n-terminal l-alanine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality