Difference between revisions of "EEF-2-Histidines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9247 == * common-name: ** cis-vaccenate * smiles: ** ccccccc=ccccccccccc(=o)[o-] * inchi-key: ** uwhzifqppbdjpm-fplpwbnlsa-m * molecu...") |
(Created page with "Category:metabolite == Metabolite CPD-19158 == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-19158 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-(9z)-hexadecenoyl-coa |
* smiles: | * smiles: | ||
| − | ** ccccccc= | + | ** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jdnargywmlyada-mdmkaecgsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1013.883 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17791]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17790]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1013.883}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-19158
- common-name:
- 3-oxo-(9z)-hexadecenoyl-coa
- smiles:
- ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- jdnargywmlyada-mdmkaecgsa-j
- molecular-weight:
- 1013.883
