Difference between revisions of "INOSITOL-1-3-4-TRIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SUC-COA ==
+
== Metabolite 2-OCTAPRENYLPHENOL ==
 
* common-name:
 
* common-name:
** succinyl-coa
+
** 2-octaprenylphenol
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** vnoyujkhfwywir-itiydsspsa-i
+
** vunqjppptjiren-cmaxttdksa-n
 
* molecular-weight:
 
* molecular-weight:
** 862.568
+
** 639.058
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AKGDHe2r]]
+
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
* [[HOMSUCTRAN-RXN]]
 
* [[RXN0-1147]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2OXOGLUTARATEDEH-RXN]]
 
* [[AKGDHe2r]]
 
* [[RXN0-1147]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=succinyl-coa}}
+
{{#set: common-name=2-octaprenylphenol}}
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
+
{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
{{#set: molecular-weight=862.568}}
+
{{#set: molecular-weight=639.058}}

Revision as of 08:28, 15 March 2021

Metabolite 2-OCTAPRENYLPHENOL

  • common-name:
    • 2-octaprenylphenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • vunqjppptjiren-cmaxttdksa-n
  • molecular-weight:
    • 639.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality