Difference between revisions of "AICAR"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14115 == * common-name: ** (s)-equol * smiles: ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) * inchi-key: ** adfcqwzhkcxpaj-gfccveg...") |
(Created page with "Category:metabolite == Metabolite 16S-rRNA-cytidine1402 == * common-name: ** a cytidine1402 in 16s rrna == Reaction(s) known to consume the compound == * RXN-11637 * [...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 16S-rRNA-cytidine1402 == |
* common-name: | * common-name: | ||
− | ** | + | ** a cytidine1402 in 16s rrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11637]] |
+ | * [[RXN-11638]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a cytidine1402 in 16s rrna}} |
− | |||
− |
Revision as of 08:28, 15 March 2021
Contents
Metabolite 16S-rRNA-cytidine1402
- common-name:
- a cytidine1402 in 16s rrna