Difference between revisions of "CPD-14900"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19150 == * common-name: ** (2e,5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
(Created page with "Category:metabolite == Metabolite D-Glc-NAc--Glycoproteins == * common-name: ** an n-acetyl-β-d-glucosaminyl-[glycoprotein] == Reaction(s) known to consume the compou...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19150 ==
+
== Metabolite D-Glc-NAc--Glycoproteins ==
 
* common-name:
 
* common-name:
** (2e,5z)-dodecenoyl-coa
+
** an n-acetyl-β-d-glucosaminyl-[glycoprotein]
* smiles:
 
** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** zsjrxhrcabosnc-shjpognxsa-j
 
* molecular-weight:
 
** 941.776
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17797]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17796]]
+
* [[RXN-15205]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,5z)-dodecenoyl-coa}}
+
{{#set: common-name=an n-acetyl-β-d-glucosaminyl-[glycoprotein]}}
{{#set: inchi-key=inchikey=zsjrxhrcabosnc-shjpognxsa-j}}
 
{{#set: molecular-weight=941.776}}
 

Revision as of 08:28, 15 March 2021

Metabolite D-Glc-NAc--Glycoproteins

  • common-name:
    • an n-acetyl-β-d-glucosaminyl-[glycoprotein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-acetyl-β-d-glucosaminyl-[glycoprotein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.