Difference between revisions of "1-Linoleoyl-2-acyl-glycerolipids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13559 == * common-name: ** α-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-pqmkyfcfsa-...")
(Created page with "Category:metabolite == Metabolite CPD-7649 == * common-name: ** dopamine 3-o-sulfate * smiles: ** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1) * inchi-key: ** nzkryjgnypyxjz-u...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13559 ==
+
== Metabolite CPD-7649 ==
 
* common-name:
 
* common-name:
** α-d-mannopyranose
+
** dopamine 3-o-sulfate
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o)o1)
+
** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
 
* inchi-key:
 
* inchi-key:
** wqzgkkkjijffok-pqmkyfcfsa-n
+
** nzkryjgnypyxjz-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 233.239
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.24-RXN]]
+
* [[RXN6666-9]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-mannopyranose}}
+
{{#set: common-name=dopamine 3-o-sulfate}}
{{#set: inchi-key=inchikey=wqzgkkkjijffok-pqmkyfcfsa-n}}
+
{{#set: inchi-key=inchikey=nzkryjgnypyxjz-uhfffaoysa-n}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=233.239}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-7649

  • common-name:
    • dopamine 3-o-sulfate
  • smiles:
    • c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
  • inchi-key:
    • nzkryjgnypyxjz-uhfffaoysa-n
  • molecular-weight:
    • 233.239

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality