Difference between revisions of "CPD-7139"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == * common-name: ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c(nc=o)c(=o)nc1(c...") |
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCEROL-P == * common-name: ** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INDOLE-3-GLYCEROL-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nqeqtypjsiephw-mnovxskesa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 285.193 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-2381]] |
| − | * [[ | + | * [[TRYPSYN-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[IGPSYN-RXN]] |
| − | * [[ | + | * [[RXN0-2381]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nqeqtypjsiephw-mnovxskesa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=285.193}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite INDOLE-3-GLYCEROL-P
- common-name:
- (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate
- smiles:
- c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o)
- inchi-key:
- nqeqtypjsiephw-mnovxskesa-l
- molecular-weight:
- 285.193
