Difference between revisions of "Protein-Arginine-Phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GMP == * common-name: ** gmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** rqfcjasxjcidsx-...")
(Created page with "Category:metabolite == Metabolite Lipoyl-Protein-N6-lipoyllysine == * common-name: ** a [lipoyl-carrier protein]-n6-lipoyl-l-lysine == Reaction(s) known to consume the com...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GMP ==
+
== Metabolite Lipoyl-Protein-N6-lipoyllysine ==
 
* common-name:
 
* common-name:
** gmp
+
** a [lipoyl-carrier protein]-n6-lipoyl-l-lysine
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
** rqfcjasxjcidsx-uuokfmhzsa-l
 
* molecular-weight:
 
** 361.207
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AGPT]]
 
* [[GMP-REDUCT-RXN]]
 
* [[GUANPRIBOSYLTRAN-RXN]]
 
* [[GUANYL-KIN-RXN]]
 
* [[RXN-7609]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.1.17-RXN]]
+
* [[1.8.1.4-RXN]]
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
+
* [[RXN-17127]]
* [[GMP-SYN-GLUT-RXN]]
+
* [[RXN-8655]]
* [[GMP-SYN-NH3-RXN]]
+
* [[RXN0-949]]
* [[GUANOSINE-DIPHOSPHATASE-RXN]]
 
* [[GUANPRIBOSYLTRAN-RXN]]
 
* [[NTDP]]
 
* [[RXN-14140]]
 
* [[RXN-14201]]
 
* [[RXN-15713]]
 
* [[RXN-17923]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gmp}}
+
{{#set: common-name=a [lipoyl-carrier protein]-n6-lipoyl-l-lysine}}
{{#set: inchi-key=inchikey=rqfcjasxjcidsx-uuokfmhzsa-l}}
 
{{#set: molecular-weight=361.207}}
 

Revision as of 08:29, 15 March 2021

Metabolite Lipoyl-Protein-N6-lipoyllysine

  • common-name:
    • a [lipoyl-carrier protein]-n6-lipoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [lipoyl-carrier protein]-n6-lipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.