Difference between revisions of "Polynucleotide-Holder"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9903 == * common-name: ** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=...")
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYSTEARATE == * common-name: ** (r)-2-hydroxystearate * smiles: ** ccccccccccccccccc(o)c(=o)[o-] * inchi-key: ** kihbgtrzfavzrv-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9903 ==
+
== Metabolite R-2-HYDROXYSTEARATE ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
+
** (r)-2-hydroxystearate
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
+
** ccccccccccccccccc(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** lieylsgxgoxytd-ctbyciiysa-m
+
** kihbgtrzfavzrv-qgzvfwflsa-m
 
* molecular-weight:
 
* molecular-weight:
** 629.941
+
** 299.473
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9287]]
+
* [[RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]]
 +
* [[RXN-11820-STEARIC_ACID/HYDROGEN-PEROXIDE//R-2-HYDROXYSTEARATE/WATER.58.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: common-name=(r)-2-hydroxystearate}}
{{#set: inchi-key=inchikey=lieylsgxgoxytd-ctbyciiysa-m}}
+
{{#set: inchi-key=inchikey=kihbgtrzfavzrv-qgzvfwflsa-m}}
{{#set: molecular-weight=629.941}}
+
{{#set: molecular-weight=299.473}}

Revision as of 08:29, 15 March 2021

Metabolite R-2-HYDROXYSTEARATE

  • common-name:
    • (r)-2-hydroxystearate
  • smiles:
    • ccccccccccccccccc(o)c(=o)[o-]
  • inchi-key:
    • kihbgtrzfavzrv-qgzvfwflsa-m
  • molecular-weight:
    • 299.473

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality