Difference between revisions of "NMNH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7279 == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o * inchi-key: ** ztalkmxohwqnia-t...")
(Created page with "Category:metabolite == Metabolite CPD-15653 == * common-name: ** (3r)-hydroxy, 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7279 ==
+
== Metabolite CPD-15653 ==
 
* common-name:
 
* common-name:
** 2-cis,4-trans-xanthoxin
+
** (3r)-hydroxy, 6-cis-tridecenoyl-coa
 
* smiles:
 
* smiles:
** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
+
** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ztalkmxohwqnia-tvbshjcbsa-n
+
** adzjvtnixnsngu-ukoyhulusa-j
 
* molecular-weight:
 
* molecular-weight:
** 250.337
+
** 973.818
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.288-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-698]]
+
* [[RXN-14772]]
* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-cis,4-trans-xanthoxin}}
+
{{#set: common-name=(3r)-hydroxy, 6-cis-tridecenoyl-coa}}
{{#set: inchi-key=inchikey=ztalkmxohwqnia-tvbshjcbsa-n}}
+
{{#set: inchi-key=inchikey=adzjvtnixnsngu-ukoyhulusa-j}}
{{#set: molecular-weight=250.337}}
+
{{#set: molecular-weight=973.818}}

Revision as of 08:29, 15 March 2021

Metabolite CPD-15653

  • common-name:
    • (3r)-hydroxy, 6-cis-tridecenoyl-coa
  • smiles:
    • ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • adzjvtnixnsngu-ukoyhulusa-j
  • molecular-weight:
    • 973.818

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality