Difference between revisions of "CPD-7279"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2500 == * common-name: ** p-nitrophenyl-α-d-galactopyranoside * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o...")
(Created page with "Category:metabolite == Metabolite 4-AMINO-BUTYRATE == * common-name: ** 4-aminobutanoate * smiles: ** c(c[n+])cc([o-])=o * inchi-key: ** btcsszjgundroe-uhfffaoysa-n * mole...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2500 ==
+
== Metabolite 4-AMINO-BUTYRATE ==
 
* common-name:
 
* common-name:
** p-nitrophenyl-α-d-galactopyranoside
+
** 4-aminobutanoate
 
* smiles:
 
* smiles:
** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
+
** c(c[n+])cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** ifbhrqdfsncloz-iirvcbmxsa-n
+
** btcsszjgundroe-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 301.252
+
** 103.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17830]]
+
* [[GABATRANSAM-RXN]]
 +
* [[RXN-14209]]
 +
* [[TRANS-RXN-261]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GABATRANSAM-RXN]]
 +
* [[GLUTDECARBOX-RXN]]
 +
* [[RXN-14209]]
 +
* [[TRANS-RXN-261]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=p-nitrophenyl-α-d-galactopyranoside}}
+
{{#set: common-name=4-aminobutanoate}}
{{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}}
+
{{#set: inchi-key=inchikey=btcsszjgundroe-uhfffaoysa-n}}
{{#set: molecular-weight=301.252}}
+
{{#set: molecular-weight=103.121}}

Revision as of 08:29, 15 March 2021

Metabolite 4-AMINO-BUTYRATE

  • common-name:
    • 4-aminobutanoate
  • smiles:
    • c(c[n+])cc([o-])=o
  • inchi-key:
    • btcsszjgundroe-uhfffaoysa-n
  • molecular-weight:
    • 103.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality