Difference between revisions of "CPD-13040"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Myelin-N-o-methyl-arginines == * common-name: ** [myelin basic protein]-nω-methyl-arginine == Reaction(s) known to consume the comp...") |
(Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * smiles: ** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == |
* common-name: | * common-name: | ||
| − | ** [ | + | ** luteolin 7-o-β-d-diglucuronide |
| + | * smiles: | ||
| + | ** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o | ||
| + | * inchi-key: | ||
| + | ** pbbvwjqpazyqdb-dbfweqbmsa-l | ||
| + | * molecular-weight: | ||
| + | ** 636.476 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15288]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=luteolin 7-o-β-d-diglucuronide}} |
| + | {{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}} | ||
| + | {{#set: molecular-weight=636.476}} | ||
Revision as of 08:29, 15 March 2021
Contents
Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE
- common-name:
- luteolin 7-o-β-d-diglucuronide
- smiles:
- c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
- inchi-key:
- pbbvwjqpazyqdb-dbfweqbmsa-l
- molecular-weight:
- 636.476
