Difference between revisions of "CPD-23709"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8122 == * common-name: ** molybdopterin adenine dinucleotide * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite GLC-D-LACTONE == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(c(c(c1o)o)o)=o) * inchi-key: ** phoqvhqstubqqk-sqougzdysa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8122 ==
+
== Metabolite GLC-D-LACTONE ==
 
* common-name:
 
* common-name:
** molybdopterin adenine dinucleotide
+
** d-glucono-1,5-lactone
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ5(o[ch]4(nc6(n=c(nc(=o)c(n[ch]4c(=c5[s-])s)=6)n))))(=o)[o-]
+
** c(o)c1(oc(c(c(c1o)o)o)=o)
 
* inchi-key:
 
* inchi-key:
** xjxfaxluokqpaq-yprlvjtjsa-k
+
** phoqvhqstubqqk-sqougzdysa-n
 
* molecular-weight:
 
* molecular-weight:
** 721.529
+
** 178.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8348]]
+
* [[GLUCONOLACT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8344]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=molybdopterin adenine dinucleotide}}
+
{{#set: common-name=d-glucono-1,5-lactone}}
{{#set: inchi-key=inchikey=xjxfaxluokqpaq-yprlvjtjsa-k}}
+
{{#set: inchi-key=inchikey=phoqvhqstubqqk-sqougzdysa-n}}
{{#set: molecular-weight=721.529}}
+
{{#set: molecular-weight=178.141}}

Revision as of 08:29, 15 March 2021

Metabolite GLC-D-LACTONE

  • common-name:
    • d-glucono-1,5-lactone
  • smiles:
    • c(o)c1(oc(c(c(c1o)o)o)=o)
  • inchi-key:
    • phoqvhqstubqqk-sqougzdysa-n
  • molecular-weight:
    • 178.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality