Difference between revisions of "AMINOMETHYLDIHYDROLIPOYL-GCVH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Beta-Lactams == * common-name: ** a β-lactam == Reaction(s) known to consume the compound == * BETA-LACTAMASE-RXN == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-14596 == * common-name: ** neolinustatin * smiles: ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** wosy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Beta-Lactams ==
+
== Metabolite CPD-14596 ==
 
* common-name:
 
* common-name:
** a β-lactam
+
** neolinustatin
 +
* smiles:
 +
** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
 +
* inchi-key:
 +
** wosyvgndrybqcq-bargltkpsa-n
 +
* molecular-weight:
 +
** 423.416
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BETA-LACTAMASE-RXN]]
+
* [[RXN-13603]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a β-lactam}}
+
{{#set: common-name=neolinustatin}}
 +
{{#set: inchi-key=inchikey=wosyvgndrybqcq-bargltkpsa-n}}
 +
{{#set: molecular-weight=423.416}}

Revision as of 08:29, 15 March 2021

Metabolite CPD-14596

  • common-name:
    • neolinustatin
  • smiles:
    • ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
  • inchi-key:
    • wosyvgndrybqcq-bargltkpsa-n
  • molecular-weight:
    • 423.416

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality