Difference between revisions of "CPD-698"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10590 == * common-name: ** (24r,25r)-3α,7α,24-trihydroxy-5β-cholestanoyl coa * smiles: ** cc(ccc(o)c(c)c(sccnc(=o)cc...")
(Created page with "Category:metabolite == Metabolite CPD-3713 == * common-name: ** cytidine 2',3'-cyclic monophosphate * smiles: ** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o * in...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10590 ==
+
== Metabolite CPD-3713 ==
 
* common-name:
 
* common-name:
** (24r,25r)-3α,7α,24-trihydroxy-5β-cholestanoyl coa
+
** cytidine 2',3'-cyclic monophosphate
 
* smiles:
 
* smiles:
** cc(ccc(o)c(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4cc[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7))))
+
** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o
 
* inchi-key:
 
* inchi-key:
** szbmuaijwnjarr-uizkvwqnsa-j
+
** nmpzcczxcomsdq-xvfcmesisa-m
 
* molecular-weight:
 
* molecular-weight:
** 1196.145
+
** 304.176
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12059]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9847]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(24r,25r)-3α,7α,24-trihydroxy-5β-cholestanoyl coa}}
+
{{#set: common-name=cytidine 2',3'-cyclic monophosphate}}
{{#set: inchi-key=inchikey=szbmuaijwnjarr-uizkvwqnsa-j}}
+
{{#set: inchi-key=inchikey=nmpzcczxcomsdq-xvfcmesisa-m}}
{{#set: molecular-weight=1196.145}}
+
{{#set: molecular-weight=304.176}}

Revision as of 08:29, 15 March 2021

Metabolite CPD-3713

  • common-name:
    • cytidine 2',3'-cyclic monophosphate
  • smiles:
    • c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o
  • inchi-key:
    • nmpzcczxcomsdq-xvfcmesisa-m
  • molecular-weight:
    • 304.176

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality