Difference between revisions of "CPD-8529"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARNOSINE == * common-name: ** carnosine * smiles: ** c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+] * inchi-key: ** cqovpnpjlqnmdc-zetcqymhsa-n...") |
(Created page with "Category:metabolite == Metabolite CPD-7616 == * common-name: ** 3,4-dihydroxybenzaldehyde * smiles: ** c(c1(c=c(c(=cc=1)o)o))=o * inchi-key: ** ibgbgrvkpalmcq-uhfffaoysa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7616 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,4-dihydroxybenzaldehyde |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c1(c=c(c(=cc=1)o)o))=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ibgbgrvkpalmcq-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 138.123 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8872]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxybenzaldehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ibgbgrvkpalmcq-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=138.123}} |
Revision as of 08:30, 15 March 2021
Contents
Metabolite CPD-7616
- common-name:
- 3,4-dihydroxybenzaldehyde
- smiles:
- c(c1(c=c(c(=cc=1)o)o))=o
- inchi-key:
- ibgbgrvkpalmcq-uhfffaoysa-n
- molecular-weight:
- 138.123
