Difference between revisions of "C3"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ARGININO-SUCCINATE == * common-name: ** l-arginino-succinate * smiles: ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] * inchi...") |
(Created page with "Category:metabolite == Metabolite 1-Alkyl-2-acyl-glycerol-3-phosphate == * common-name: ** a 2-acyl-1-alkyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the com...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-Alkyl-2-acyl-glycerol-3-phosphate == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2-acyl-1-alkyl-sn-glycerol 3-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17730]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17729]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2-acyl-1-alkyl-sn-glycerol 3-phosphate}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite 1-Alkyl-2-acyl-glycerol-3-phosphate
- common-name:
- a 2-acyl-1-alkyl-sn-glycerol 3-phosphate
