Difference between revisions of "MANNOSE-6P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Nucleoside-Triphosphates == * common-name: ** a nucleoside triphosphate == Reaction(s) known to consume the compound == * [[2.7.4.10-RXN]...") |
(Created page with "Category:metabolite == Metabolite CPD-14202 == * common-name: ** l-erythro-7,8-dihydrobiopterin * smiles: ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) * inchi-key: ** femxzdut...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14202 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-erythro-7,8-dihydrobiopterin |
| + | * smiles: | ||
| + | ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) | ||
| + | * inchi-key: | ||
| + | ** femxzdutfrtwpe-dzswipipsa-n | ||
| + | * molecular-weight: | ||
| + | ** 239.233 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[SEPIAPTERIN-REDUCTASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7908]] |
| − | + | * [[SEPIAPTERIN-REDUCTASE-RXN]] | |
| − | * [[ | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-erythro-7,8-dihydrobiopterin}} |
| + | {{#set: inchi-key=inchikey=femxzdutfrtwpe-dzswipipsa-n}} | ||
| + | {{#set: molecular-weight=239.233}} | ||
Revision as of 08:30, 15 March 2021
Contents
Metabolite CPD-14202
- common-name:
- l-erythro-7,8-dihydrobiopterin
- smiles:
- cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n))
- inchi-key:
- femxzdutfrtwpe-dzswipipsa-n
- molecular-weight:
- 239.233
