Difference between revisions of "3Prime-OH-Terminated-RNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BETA-TOCOPHEROL == * common-name: ** β-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c)) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite 2-O-MeGuan-34-tRNAs == * common-name: ** a 2'-o-methylguanosine34 in trna == Reaction(s) known to consume the compound == == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-O-MeGuan-34-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2'-o-methylguanosine34 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11868]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2'-o-methylguanosine34 in trna}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite 2-O-MeGuan-34-tRNAs
- common-name:
- a 2'-o-methylguanosine34 in trna
