Difference between revisions of "Chitodextrins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-431 == * common-name: ** apigenin * smiles: ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3))) * inchi-key: ** kznifhplkgyrtm-u...") |
(Created page with "Category:metabolite == Metabolite Heparan-NAc-Glc == * common-name: ** a [heparan]-n-acetyl-α-d-glucosamine == Reaction(s) known to consume the compound == == Reacti...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Heparan-NAc-Glc == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [heparan]-n-acetyl-α-d-glucosamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.1.6.14-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [heparan]-n-acetyl-α-d-glucosamine}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite Heparan-NAc-Glc
- common-name:
- a [heparan]-n-acetyl-α-d-glucosamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [heparan]-n-acetyl-α-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
